About (4S)-3,4-dihydro-2H-thiochromen-4-ol
(4S)-3,4-dihydro-2H-thiochromen-4-ol (PubChem CID 8001140) has the molecular formula C9H10OS
and a molecular weight of 166.25 g/mol. Its IUPAC name is (4S)-3,4-dihydro-2H-thiochromen-4-ol.
Molecular Properties
| Compound Name | (4S)-3,4-dihydro-2H-thiochromen-4-ol |
| PubChem CID | 8001140 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | (4S)-3,4-dihydro-2H-thiochromen-4-ol |
| SMILES | O[C@H]1CCSc2ccccc21 |
| InChI | InChI=1S/C9H10OS/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-4,8,10H,5-6H2/t8-/m0/s1 |
| InChIKey | FWVSZXYNCFXKRT-QMMMGPOBSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-3,4-dihydro-2H-thiochromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3,4-dihydro-2H-thiochromen-4-ol?
The IUPAC name of (4S)-3,4-dihydro-2H-thiochromen-4-ol (CID 8001140) is (4S)-3,4-dihydro-2H-thiochromen-4-ol.
What is the SMILES notation for (4S)-3,4-dihydro-2H-thiochromen-4-ol?
The canonical SMILES for (4S)-3,4-dihydro-2H-thiochromen-4-ol is O[C@H]1CCSc2ccccc21.
What is the InChIKey of (4S)-3,4-dihydro-2H-thiochromen-4-ol?
The InChIKey is FWVSZXYNCFXKRT-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H10OS/c10-8-5-6-11-9-4-2-1-3-7(8)9/h1-4,8,10H,5-6H2/t8-/m0/s1.
What are the key properties of (4S)-3,4-dihydro-2H-thiochromen-4-ol?
(4S)-3,4-dihydro-2H-thiochromen-4-ol has a molecular weight of 166.25 g/mol, XLogP of 2.22, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3,4-dihydro-2H-thiochromen-4-ol is sourced from PubChem (CID 8001140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).