C27H26N2O2 — CID 8001502
(3S,4'R)-4'-(2,3-dimethoxyphenyl)spiro[1,2-dihydroindene-3,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole] (PubChem CID 8001502) has the molecular formula C27H26N2O2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (3S,4'R)-4'-(2,3-dimethoxyphenyl)spiro[1,2-dihydroindene-3,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole].
| Compound Name | (3S,4'R)-4'-(2,3-dimethoxyphenyl)spiro[1,2-dihydroindene-3,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole] |
|---|---|
| PubChem CID | 8001502 |
| Molecular Formula | C27H26N2O2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | (3S,4'R)-4'-(2,3-dimethoxyphenyl)spiro[1,2-dihydroindene-3,1'-2,3,4,9-tetrahydropyrido[3,4-b]indole] |
| SMILES | COc1cccc([C@@H]2CN[C@]3(CCc4ccccc43)c3[nH]c4ccccc4c32)c1OC |
| InChI | InChI=1S/C27H26N2O2/c1-30-23-13-7-10-18(25(23)31-2)20-16-28-27(15-14-17-8-3-5-11-21(17)27)26-24(20)19-9-4-6-12-22(19)29-26/h3-13,20,28-29H,14-16H2,1-2H3/t20-,27-/m0/s1 |
| InChIKey | WKSPXDADRMWNJM-DCFHFQCYSA-N |
| XLogP | 5.11 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |