C13H14N2O3S — CID 800208
3-(2-morpholin-4-yl-2-oxoethyl)-1,3-benzothiazol-2-one (PubChem CID 800208) has the molecular formula C13H14N2O3S and a molecular weight of 278.33 g/mol. Its IUPAC name is 3-(2-morpholin-4-yl-2-oxoethyl)-1,3-benzothiazol-2-one.
| Compound Name | 3-(2-morpholin-4-yl-2-oxoethyl)-1,3-benzothiazol-2-one |
|---|---|
| PubChem CID | 800208 |
| Molecular Formula | C13H14N2O3S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.07 |
| IUPAC Name | 3-(2-morpholin-4-yl-2-oxoethyl)-1,3-benzothiazol-2-one |
| SMILES | O=C(Cn1c(=O)sc2ccccc21)N1CCOCC1 |
| InChI | InChI=1S/C13H14N2O3S/c16-12(14-5-7-18-8-6-14)9-15-10-3-1-2-4-11(10)19-13(15)17/h1-4H,5-9H2 |
| InChIKey | OHCAHYUISQHMTQ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |