C16H27N3O3S — CID 8002731
1-tert-butyl-3-[3-(diethylsulfamoyl)-4-methylphenyl]urea (PubChem CID 8002731) has the molecular formula C16H27N3O3S and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-(diethylsulfamoyl)-4-methylphenyl]urea.
| Compound Name | 1-tert-butyl-3-[3-(diethylsulfamoyl)-4-methylphenyl]urea |
|---|---|
| PubChem CID | 8002731 |
| Molecular Formula | C16H27N3O3S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 1-tert-butyl-3-[3-(diethylsulfamoyl)-4-methylphenyl]urea |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)NC(C)(C)C)ccc1C |
| InChI | InChI=1S/C16H27N3O3S/c1-7-19(8-2)23(21,22)14-11-13(10-9-12(14)3)17-15(20)18-16(4,5)6/h9-11H,7-8H2,1-6H3,(H2,17,18,20) |
| InChIKey | HRLOCBYYPZKVKX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |