C13H15F3N2O2 — CID 80028294
2-amino-N-(oxan-3-yl)-3-(trifluoromethyl)benzamide (PubChem CID 80028294) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is 2-amino-N-(oxan-3-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-(oxan-3-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 80028294 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-amino-N-(oxan-3-yl)-3-(trifluoromethyl)benzamide |
| SMILES | C1CC(COC1)NC(=O)C2=C(C(=CC=C2)C(F)(F)F)N |
| InChI | InChI=1S/C13H15F3N2O2/c14-13(15,16)10-5-1-4-9(11(10)17)12(19)18-8-3-2-6-20-7-8/h1,4-5,8H,2-3,6-7,17H2,(H,18,19) |
| InChIKey | AQKOPHRSEWDURJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | 349 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|