C19H21NO6S — CID 8002918
2-[(4-methylphenyl)sulfonylamino]ethyl 3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylate (PubChem CID 8002918) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]ethyl 3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylate.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]ethyl 3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylate |
|---|---|
| PubChem CID | 8002918 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]ethyl 3,4-dihydro-2H-1,5-benzodioxepine-7-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)NCCOC(=O)c2ccc3c(c2)OCCCO3)cc1 |
| InChI | InChI=1S/C19H21NO6S/c1-14-3-6-16(7-4-14)27(22,23)20-9-12-26-19(21)15-5-8-17-18(13-15)25-11-2-10-24-17/h3-8,13,20H,2,9-12H2,1H3 |
| InChIKey | CIWFFLCTLPDNCG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|