About 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea
1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea (PubChem CID 800294) has the molecular formula C16H19N3O2S2
and a molecular weight of 349.48 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea.
Molecular Properties
| Compound Name | 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea |
| PubChem CID | 800294 |
| Molecular Formula | C16H19N3O2S2 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NCc2ccc(S(N)(=O)=O)cc2)c(C)c1 |
| InChI | InChI=1S/C16H19N3O2S2/c1-11-3-8-15(12(2)9-11)19-16(22)18-10-13-4-6-14(7-5-13)23(17,20)21/h3-9H,10H2,1-2H3,(H2,17,20,21)(H2,18,19,22) |
| InChIKey | DVQCCUBEFBZQKH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea?
The IUPAC name of 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea (CID 800294) is 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea.
What is the SMILES notation for 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea?
The canonical SMILES for 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea is Cc1ccc(NC(=S)NCc2ccc(S(N)(=O)=O)cc2)c(C)c1.
What is the InChIKey of 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea?
The InChIKey is DVQCCUBEFBZQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O2S2/c1-11-3-8-15(12(2)9-11)19-16(22)18-10-13-4-6-14(7-5-13)23(17,20)21/h3-9H,10H2,1-2H3,(H2,17,20,21)(H2,18,19,22).
What are the key properties of 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea?
1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea has a molecular weight of 349.48 g/mol, XLogP of 2.44, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-dimethylphenyl)-3-[(4-sulfamoylphenyl)methyl]thiourea is sourced from PubChem (CID 800294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).