C10H12N2OS — CID 800379
3-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 800379) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 3-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 800379 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCn1cnc2sc(C)c(C)c2c1=O |
| InChI | InChI=1S/C10H12N2OS/c1-4-12-5-11-9-8(10(12)13)6(2)7(3)14-9/h5H,4H2,1-3H3 |
| InChIKey | KJPWMEUDDWSCTN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |