C16H23N3O2 — CID 800463
1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidine-4-carboxamide (PubChem CID 800463) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 800463 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-[2-(2,6-dimethylanilino)-2-oxoethyl]piperidine-4-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)CN1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C16H23N3O2/c1-11-4-3-5-12(2)15(11)18-14(20)10-19-8-6-13(7-9-19)16(17)21/h3-5,13H,6-10H2,1-2H3,(H2,17,21)(H,18,20) |
| InChIKey | BCLHJCJSNPETKF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |