About 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione
6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione (PubChem CID 8004839) has the molecular formula C11H14N4O2S
and a molecular weight of 266.33 g/mol. Its IUPAC name is 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione |
| PubChem CID | 8004839 |
| Molecular Formula | C11H14N4O2S |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1c(N)c(-c2csc(C)n2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H14N4O2S/c1-3-4-15-9(12)8(10(16)14-11(15)17)7-5-18-6(2)13-7/h5H,3-4,12H2,1-2H3,(H,14,16,17) |
| InChIKey | WMGYFLFLQHYBOM-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 93.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione?
The IUPAC name of 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione (CID 8004839) is 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione.
What is the SMILES notation for 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione?
The canonical SMILES for 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione is CCCn1c(N)c(-c2csc(C)n2)c(=O)[nH]c1=O.
What is the InChIKey of 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione?
The InChIKey is WMGYFLFLQHYBOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O2S/c1-3-4-15-9(12)8(10(16)14-11(15)17)7-5-18-6(2)13-7/h5H,3-4,12H2,1-2H3,(H,14,16,17).
What are the key properties of 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione?
6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione has a molecular weight of 266.33 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-(2-methyl-1,3-thiazol-4-yl)-1-propylpyrimidine-2,4-dione is sourced from PubChem (CID 8004839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).