About 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea
1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea (PubChem CID 800548) has the molecular formula C14H27N3S
and a molecular weight of 269.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea |
| PubChem CID | 800548 |
| Molecular Formula | C14H27N3S |
| Molecular Weight | 269.46 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea |
| SMILES | C[C@H]1CCC[C@H](C)N1NC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C14H27N3S/c1-11-7-6-8-12(2)17(11)16-14(18)15-13-9-4-3-5-10-13/h11-13H,3-10H2,1-2H3,(H2,15,16,18)/t11-,12-/m0/s1 |
| InChIKey | WWSKCEVVJZTNLB-RYUDHWBXSA-N |
| XLogP | 2.96 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea?
The IUPAC name of 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea (CID 800548) is 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea.
What is the SMILES notation for 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea?
The canonical SMILES for 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea is C[C@H]1CCC[C@H](C)N1NC(=S)NC1CCCCC1.
What is the InChIKey of 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea?
The InChIKey is WWSKCEVVJZTNLB-RYUDHWBXSA-N. The full InChI is InChI=1S/C14H27N3S/c1-11-7-6-8-12(2)17(11)16-14(18)15-13-9-4-3-5-10-13/h11-13H,3-10H2,1-2H3,(H2,15,16,18)/t11-,12-/m0/s1.
What are the key properties of 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea?
1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea has a molecular weight of 269.46 g/mol, XLogP of 2.96, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[(2S,6S)-2,6-dimethylpiperidin-1-yl]thiourea is sourced from PubChem (CID 800548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).