C11H7F4NO2 — CID 800554
2-[3-(1,1,2,2-tetrafluoroethyl)-1,2-oxazol-5-yl]phenol (PubChem CID 800554) has the molecular formula C11H7F4NO2 and a molecular weight of 261.17 g/mol. Its IUPAC name is 2-[3-(1,1,2,2-tetrafluoroethyl)-1,2-oxazol-5-yl]phenol.
| Compound Name | 2-[3-(1,1,2,2-tetrafluoroethyl)-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 800554 |
| Molecular Formula | C11H7F4NO2 |
| Molecular Weight | 261.17 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-[3-(1,1,2,2-tetrafluoroethyl)-1,2-oxazol-5-yl]phenol |
| SMILES | Oc1ccccc1-c1cc(C(F)(F)C(F)F)no1 |
| InChI | InChI=1S/C11H7F4NO2/c12-10(13)11(14,15)9-5-8(18-16-9)6-3-1-2-4-7(6)17/h1-5,10,17H |
| InChIKey | KHVUQDAMSYBLMZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.17 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|