About 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile
4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile (PubChem CID 8006754) has the molecular formula C16H12N2S2
and a molecular weight of 296.42 g/mol. Its IUPAC name is 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile.
Molecular Properties
| Compound Name | 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile |
| PubChem CID | 8006754 |
| Molecular Formula | C16H12N2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile |
| SMILES | N#Cc1ccc(CSC2=Nc3ccccc3CS2)cc1 |
| InChI | InChI=1S/C16H12N2S2/c17-9-12-5-7-13(8-6-12)10-19-16-18-15-4-2-1-3-14(15)11-20-16/h1-8H,10-11H2 |
| InChIKey | SWVBQUSVFFLLLQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile?
The IUPAC name of 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile (CID 8006754) is 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile.
What is the SMILES notation for 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile?
The canonical SMILES for 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile is N#Cc1ccc(CSC2=Nc3ccccc3CS2)cc1.
What is the InChIKey of 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile?
The InChIKey is SWVBQUSVFFLLLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2S2/c17-9-12-5-7-13(8-6-12)10-19-16-18-15-4-2-1-3-14(15)11-20-16/h1-8H,10-11H2.
What are the key properties of 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile?
4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile has a molecular weight of 296.42 g/mol, XLogP of 4.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4H-3,1-benzothiazin-2-ylsulfanylmethyl)benzonitrile is sourced from PubChem (CID 8006754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).