C21H28N7O2+ — CID 8007820
5,6-diamino-3-[(2R)-butan-2-yl]-8-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxo-1H-pyrrolo[2,3-c][2,7]naphthyridin-7-ium-9-carbonitrile (PubChem CID 8007820) has the molecular formula C21H28N7O2+ and a molecular weight of 410.50 g/mol. Its IUPAC name is 5,6-diamino-3-[(2R)-butan-2-yl]-8-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxo-1H-pyrrolo[2,3-c][2,7]naphthyridin-7-ium-9-carbonitrile.
| Compound Name | 5,6-diamino-3-[(2R)-butan-2-yl]-8-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxo-1H-pyrrolo[2,3-c][2,7]naphthyridin-7-ium-9-carbonitrile |
|---|---|
| PubChem CID | 8007820 |
| Molecular Formula | C21H28N7O2+ |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 5,6-diamino-3-[(2R)-butan-2-yl]-8-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-2-oxo-1H-pyrrolo[2,3-c][2,7]naphthyridin-7-ium-9-carbonitrile |
| SMILES | CC[C@@H](C)N1C(=O)Cc2c1nc(N)c1c(N)[nH+]c(N3C[C@@H](C)O[C@H](C)C3)c(C#N)c21 |
| InChI | InChI=1S/C21H27N7O2/c1-5-10(2)28-15(29)6-13-16-14(7-22)20(27-8-11(3)30-12(4)9-27)25-18(23)17(16)19(24)26-21(13)28/h10-12H,5-6,8-9H2,1-4H3,(H2,23,25)(H2,24,26)/p+1/t10-,11-,12-/m1/s1 |
| InChIKey | WFIVIQGAUATJEL-IJLUTSLNSA-O |
| XLogP | 1.39 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |