C15H16N2O4S — CID 800792
(5E)-5-[(5-methylthiophen-2-yl)methylidene]-1-[[(2S)-oxolan-2-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 800792) has the molecular formula C15H16N2O4S and a molecular weight of 320.37 g/mol. Its IUPAC name is (5E)-5-[(5-methylthiophen-2-yl)methylidene]-1-[[(2S)-oxolan-2-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-[(5-methylthiophen-2-yl)methylidene]-1-[[(2S)-oxolan-2-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 800792 |
| Molecular Formula | C15H16N2O4S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | (5E)-5-[(5-methylthiophen-2-yl)methylidene]-1-[[(2S)-oxolan-2-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(/C=C2\C(=O)NC(=O)N(C[C@@H]3CCCO3)C2=O)s1 |
| InChI | InChI=1S/C15H16N2O4S/c1-9-4-5-11(22-9)7-12-13(18)16-15(20)17(14(12)19)8-10-3-2-6-21-10/h4-5,7,10H,2-3,6,8H2,1H3,(H,16,18,20)/b12-7+/t10-/m0/s1 |
| InChIKey | PYZRUFWYEWOGBS-QVIVLVACSA-N |
| XLogP | 1.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|