C8H13N3 — CID 8009163
N,N,3,6-tetramethylpyrazin-2-amine (PubChem CID 8009163) has the molecular formula C8H13N3 and a molecular weight of 151.21 g/mol. Its IUPAC name is N,N,3,6-tetramethylpyrazin-2-amine.
| Compound Name | N,N,3,6-tetramethylpyrazin-2-amine |
|---|---|
| PubChem CID | 8009163 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | N,N,3,6-tetramethylpyrazin-2-amine |
| SMILES | Cc1cnc(C)c(N(C)C)n1 |
| InChI | InChI=1S/C8H13N3/c1-6-5-9-7(2)8(10-6)11(3)4/h5H,1-4H3 |
| InChIKey | MGPSEZOAHGASTB-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |