C12H6F3N7 — CID 8009264
10-phenyl-7-(trifluoromethyl)-3,4,5,6,8,10,11-heptazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 8009264) has the molecular formula C12H6F3N7 and a molecular weight of 305.22 g/mol. Its IUPAC name is 10-phenyl-7-(trifluoromethyl)-3,4,5,6,8,10,11-heptazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 10-phenyl-7-(trifluoromethyl)-3,4,5,6,8,10,11-heptazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 8009264 |
| Molecular Formula | C12H6F3N7 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 10-phenyl-7-(trifluoromethyl)-3,4,5,6,8,10,11-heptazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | FC(F)(F)c1nc2c(cnn2-c2ccccc2)c2nnnn12 |
| InChI | InChI=1S/C12H6F3N7/c13-12(14,15)11-17-9-8(10-18-19-20-22(10)11)6-16-21(9)7-4-2-1-3-5-7/h1-6H |
| InChIKey | QLDVGLFOQRHJTP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |