C20H22N2O2S — CID 8009805
2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone (PubChem CID 8009805) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone.
| Compound Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
|---|---|
| PubChem CID | 8009805 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 2-[(3,5-dimethyl-1,2-oxazol-4-yl)methylsulfanyl]-1-(2,5-dimethyl-1-phenylpyrrol-3-yl)ethanone |
| SMILES | Cc1noc(C)c1CSCC(=O)c1cc(C)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C20H22N2O2S/c1-13-10-18(15(3)22(13)17-8-6-5-7-9-17)20(23)12-25-11-19-14(2)21-24-16(19)4/h5-10H,11-12H2,1-4H3 |
| InChIKey | YDFQFPASHKULAV-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 48.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|