About 2-(1H-indol-3-yl)acetate
2-(1H-indol-3-yl)acetate (PubChem CID 801) has the molecular formula C10H8NO2-
and a molecular weight of 174.18 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | 2-(1H-indol-3-yl)acetate |
| PubChem CID | 801 |
| Molecular Formula | C10H8NO2- |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 2-(1H-indol-3-yl)acetate |
| SMILES | O=C([O-])Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1 |
| InChIKey | SEOVTRFCIGRIMH-UHFFFAOYSA-M |
| XLogP | 0.46 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indol-3-yl)acetate?
The IUPAC name of 2-(1H-indol-3-yl)acetate (CID 801) is 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for 2-(1H-indol-3-yl)acetate?
The canonical SMILES for 2-(1H-indol-3-yl)acetate is O=C([O-])Cc1c[nH]c2ccccc12.
What is the InChIKey of 2-(1H-indol-3-yl)acetate?
The InChIKey is SEOVTRFCIGRIMH-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO2/c12-10(13)5-7-6-11-9-4-2-1-3-8(7)9/h1-4,6,11H,5H2,(H,12,13)/p-1.
What are the key properties of 2-(1H-indol-3-yl)acetate?
2-(1H-indol-3-yl)acetate has a molecular weight of 174.18 g/mol, XLogP of 0.46, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).