C18H15ClN4S — CID 8011841
3-[[5-(4-chlorophenyl)-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile (PubChem CID 8011841) has the molecular formula C18H15ClN4S and a molecular weight of 354.87 g/mol. Its IUPAC name is 3-[[5-(4-chlorophenyl)-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile.
| Compound Name | 3-[[5-(4-chlorophenyl)-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 8011841 |
| Molecular Formula | C18H15ClN4S |
| Molecular Weight | 354.87 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 3-[[5-(4-chlorophenyl)-4-(3-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanenitrile |
| SMILES | Cc1cccc(-n2c(SCCC#N)nnc2-c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C18H15ClN4S/c1-13-4-2-5-16(12-13)23-17(14-6-8-15(19)9-7-14)21-22-18(23)24-11-3-10-20/h2,4-9,12H,3,11H2,1H3 |
| InChIKey | XHQFZOIPXASTHF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.87 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|