About N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide
N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide (PubChem CID 801188) has the molecular formula C11H13N5O
and a molecular weight of 231.26 g/mol. Its IUPAC name is N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide.
Molecular Properties
| Compound Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide |
| PubChem CID | 801188 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide |
| SMILES | CC(=O)N(C)c1nc(N)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C11H13N5O/c1-8(17)15(2)11-13-10(12)16(14-11)9-6-4-3-5-7-9/h3-7H,1-2H3,(H2,12,13,14) |
| InChIKey | LZBVOGQYFJXVRF-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide?
The IUPAC name of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide (CID 801188) is N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide.
What is the SMILES notation for N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide?
The canonical SMILES for N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide is CC(=O)N(C)c1nc(N)n(-c2ccccc2)n1.
What is the InChIKey of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide?
The InChIKey is LZBVOGQYFJXVRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5O/c1-8(17)15(2)11-13-10(12)16(14-11)9-6-4-3-5-7-9/h3-7H,1-2H3,(H2,12,13,14).
What are the key properties of N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide?
N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide has a molecular weight of 231.26 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-1-phenyl-1,2,4-triazol-3-yl)-N-methylacetamide is sourced from PubChem (CID 801188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).