About N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide
N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 801259) has the molecular formula C14H9ClN2OS2
and a molecular weight of 320.83 g/mol. Its IUPAC name is N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 801259 |
| Molecular Formula | C14H9ClN2OS2 |
| Molecular Weight | 320.83 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(Cl)s2)cs1)c1ccccc1 |
| InChI | InChI=1S/C14H9ClN2OS2/c15-12-7-6-11(20-12)10-8-19-14(16-10)17-13(18)9-4-2-1-3-5-9/h1-8H,(H,16,17,18) |
| InChIKey | FOLFRFSOJLKHEX-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide?
The IUPAC name of N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide (CID 801259) is N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide is O=C(Nc1nc(-c2ccc(Cl)s2)cs1)c1ccccc1.
What is the InChIKey of N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide?
The InChIKey is FOLFRFSOJLKHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9ClN2OS2/c15-12-7-6-11(20-12)10-8-19-14(16-10)17-13(18)9-4-2-1-3-5-9/h1-8H,(H,16,17,18).
What are the key properties of N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide?
N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide has a molecular weight of 320.83 g/mol, XLogP of 4.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 801259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).