C20H22N2O2S — CID 8012636
N-(1,3-benzothiazol-2-yl)-N-butyl-2-ethoxybenzamide (PubChem CID 8012636) has the molecular formula C20H22N2O2S and a molecular weight of 354.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-N-butyl-2-ethoxybenzamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-N-butyl-2-ethoxybenzamide |
|---|---|
| PubChem CID | 8012636 |
| Molecular Formula | C20H22N2O2S |
| Molecular Weight | 354.48 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-N-butyl-2-ethoxybenzamide |
| SMILES | CCCCN(C(=O)c1ccccc1OCC)c1nc2ccccc2s1 |
| InChI | InChI=1S/C20H22N2O2S/c1-3-5-14-22(20-21-16-11-7-9-13-18(16)25-20)19(23)15-10-6-8-12-17(15)24-4-2/h6-13H,3-5,14H2,1-2H3 |
| InChIKey | NYOIQUCUFRLLKT-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.48 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |