C20H19F3N2O4 — CID 8013678
[(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-[3-(trifluoromethyl)phenyl]acetate (PubChem CID 8013678) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-[3-(trifluoromethyl)phenyl]acetate.
| Compound Name | [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-[3-(trifluoromethyl)phenyl]acetate |
|---|---|
| PubChem CID | 8013678 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(2S)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 2-[3-(trifluoromethyl)phenyl]acetate |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@H](C)OC(=O)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H19F3N2O4/c1-12(19(28)25-17-8-6-16(7-9-17)24-13(2)26)29-18(27)11-14-4-3-5-15(10-14)20(21,22)23/h3-10,12H,11H2,1-2H3,(H,24,26)(H,25,28)/t12-/m0/s1 |
| InChIKey | MCHUFDIDOIVTHP-LBPRGKRZSA-N |
| XLogP | 3.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |