C17H19NO4S — CID 801406
N-(1,3-benzodioxol-5-ylmethyl)-2,4,5-trimethylbenzenesulfonamide (PubChem CID 801406) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,4,5-trimethylbenzenesulfonamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4,5-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 801406 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4,5-trimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCc2ccc3c(c2)OCO3)cc1C |
| InChI | InChI=1S/C17H19NO4S/c1-11-6-13(3)17(7-12(11)2)23(19,20)18-9-14-4-5-15-16(8-14)22-10-21-15/h4-8,18H,9-10H2,1-3H3 |
| InChIKey | CQUJNFOGCMYIFQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |