About ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate
ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate (PubChem CID 8014362) has the molecular formula C16H16F2N2O4S2
and a molecular weight of 402.44 g/mol. Its IUPAC name is ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate |
| PubChem CID | 8014362 |
| Molecular Formula | C16H16F2N2O4S2 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(SCC(=O)Nc2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C16H16F2N2O4S2/c1-2-23-14(22)7-11-8-25-16(20-11)26-9-13(21)19-10-3-5-12(6-4-10)24-15(17)18/h3-6,8,15H,2,7,9H2,1H3,(H,19,21) |
| InChIKey | QQRAYUYNWBEBLM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate?
The IUPAC name of ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate (CID 8014362) is ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate?
The canonical SMILES for ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate is CCOC(=O)Cc1csc(SCC(=O)Nc2ccc(OC(F)F)cc2)n1.
What is the InChIKey of ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate?
The InChIKey is QQRAYUYNWBEBLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16F2N2O4S2/c1-2-23-14(22)7-11-8-25-16(20-11)26-9-13(21)19-10-3-5-12(6-4-10)24-15(17)18/h3-6,8,15H,2,7,9H2,1H3,(H,19,21).
What are the key properties of ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate?
ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate has a molecular weight of 402.44 g/mol, XLogP of 3.58, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 8014362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).