C14H11BrN2O4 — CID 8015889
(1R,10R)-16-bromo-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-2(7),13(18),14,16-tetraene-3,5-dione (PubChem CID 8015889) has the molecular formula C14H11BrN2O4 and a molecular weight of 351.16 g/mol. Its IUPAC name is (1R,10R)-16-bromo-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-2(7),13(18),14,16-tetraene-3,5-dione.
| Compound Name | (1R,10R)-16-bromo-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-2(7),13(18),14,16-tetraene-3,5-dione |
|---|---|
| PubChem CID | 8015889 |
| Molecular Formula | C14H11BrN2O4 |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 349.99 |
| IUPAC Name | (1R,10R)-16-bromo-8,12-dioxa-4,6-diazatetracyclo[8.8.0.02,7.013,18]octadeca-2(7),13(18),14,16-tetraene-3,5-dione |
| SMILES | O=c1[nH]c2c(c(=O)[nH]1)[C@H]1c3cc(Br)ccc3OC[C@@H]1CO2 |
| InChI | InChI=1S/C14H11BrN2O4/c15-7-1-2-9-8(3-7)10-6(4-20-9)5-21-13-11(10)12(18)16-14(19)17-13/h1-3,6,10H,4-5H2,(H2,16,17,18,19)/t6-,10-/m1/s1 |
| InChIKey | GMUWEIQHPNRWBM-LHLIQPBNSA-N |
| XLogP | 1.36 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |