About (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate
(2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate (PubChem CID 8015997) has the molecular formula C15H12N3O3-
and a molecular weight of 282.28 g/mol. Its IUPAC name is (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate.
Molecular Properties
| Compound Name | (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate |
| PubChem CID | 8015997 |
| Molecular Formula | C15H12N3O3- |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)c1cc2c(cn1)[nH]c1ccccc12)C(=O)[O-] |
| InChI | InChI=1S/C15H13N3O3/c1-8(15(20)21)17-14(19)12-6-10-9-4-2-3-5-11(9)18-13(10)7-16-12/h2-8,18H,1H3,(H,17,19)(H,20,21)/p-1/t8-/m0/s1 |
| InChIKey | DQUWNDZDGZGFEB-QMMMGPOBSA-M |
| XLogP | 0.58 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate?
The IUPAC name of (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate (CID 8015997) is (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate.
What is the SMILES notation for (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate?
The canonical SMILES for (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate is C[C@H](NC(=O)c1cc2c(cn1)[nH]c1ccccc12)C(=O)[O-].
What is the InChIKey of (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate?
The InChIKey is DQUWNDZDGZGFEB-QMMMGPOBSA-M. The full InChI is InChI=1S/C15H13N3O3/c1-8(15(20)21)17-14(19)12-6-10-9-4-2-3-5-11(9)18-13(10)7-16-12/h2-8,18H,1H3,(H,17,19)(H,20,21)/p-1/t8-/m0/s1.
What are the key properties of (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate?
(2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate has a molecular weight of 282.28 g/mol, XLogP of 0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(9H-pyrido[3,4-b]indole-3-carbonylamino)propanoate is sourced from PubChem (CID 8015997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).