C24H20N4O2 — CID 8016355
10-(4-methylpiperazine-1-carbonyl)-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaen-19-one (PubChem CID 8016355) has the molecular formula C24H20N4O2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 10-(4-methylpiperazine-1-carbonyl)-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaen-19-one.
| Compound Name | 10-(4-methylpiperazine-1-carbonyl)-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaen-19-one |
|---|---|
| PubChem CID | 8016355 |
| Molecular Formula | C24H20N4O2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 10-(4-methylpiperazine-1-carbonyl)-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8,10,12(20),13,15,17-nonaen-19-one |
| SMILES | CN1CCN(C(=O)c2cc3c4ccccc4n4c(=O)c5ccccc5c(n2)c34)CC1 |
| InChI | InChI=1S/C24H20N4O2/c1-26-10-12-27(13-11-26)24(30)19-14-18-15-6-4-5-9-20(15)28-22(18)21(25-19)16-7-2-3-8-17(16)23(28)29/h2-9,14H,10-13H2,1H3 |
| InChIKey | RWOQRUQWCARUGY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|