C22H16N2O2 — CID 8016389
5-(2-methylprop-2-enoxy)-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13,15,17-nonaen-19-one (PubChem CID 8016389) has the molecular formula C22H16N2O2 and a molecular weight of 340.38 g/mol. Its IUPAC name is 5-(2-methylprop-2-enoxy)-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13,15,17-nonaen-19-one.
| Compound Name | 5-(2-methylprop-2-enoxy)-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13,15,17-nonaen-19-one |
|---|---|
| PubChem CID | 8016389 |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 5-(2-methylprop-2-enoxy)-1,11-diazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2(7),3,5,8(20),9,11,13,15,17-nonaen-19-one |
| SMILES | C=C(C)COc1ccc2c(c1)c1ccnc3c4ccccc4c(=O)n2c13 |
| InChI | InChI=1S/C22H16N2O2/c1-13(2)12-26-14-7-8-19-18(11-14)16-9-10-23-20-15-5-3-4-6-17(15)22(25)24(19)21(16)20/h3-11H,1,12H2,2H3 |
| InChIKey | VLLMYZBEZHVFPM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|