C24H27N3O3 — CID 8016591
(1R,5R,6S,7S)-3-cyclopentyl-N-[2-(1H-indol-3-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide (PubChem CID 8016591) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is (1R,5R,6S,7S)-3-cyclopentyl-N-[2-(1H-indol-3-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide.
| Compound Name | (1R,5R,6S,7S)-3-cyclopentyl-N-[2-(1H-indol-3-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
|---|---|
| PubChem CID | 8016591 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | (1R,5R,6S,7S)-3-cyclopentyl-N-[2-(1H-indol-3-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)[C@@H]1[C@@H]2C=C[C@@]3(CN(C4CCCC4)C(=O)[C@H]13)O2 |
| InChI | InChI=1S/C24H27N3O3/c28-22(25-12-10-15-13-26-18-8-4-3-7-17(15)18)20-19-9-11-24(30-19)14-27(23(29)21(20)24)16-5-1-2-6-16/h3-4,7-9,11,13,16,19-21,26H,1-2,5-6,10,12,14H2,(H,25,28)/t19-,20+,21-,24-/m0/s1 |
| InChIKey | JMQHDPGEFRNBMV-XARGGIHNSA-N |
| XLogP | 2.55 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|