C23H24N2O5 — CID 8016637
N-pyridin-3-yl-2-[(3,4,8,8-tetramethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetamide (PubChem CID 8016637) has the molecular formula C23H24N2O5 and a molecular weight of 408.45 g/mol. Its IUPAC name is N-pyridin-3-yl-2-[(3,4,8,8-tetramethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetamide.
| Compound Name | N-pyridin-3-yl-2-[(3,4,8,8-tetramethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetamide |
|---|---|
| PubChem CID | 8016637 |
| Molecular Formula | C23H24N2O5 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | N-pyridin-3-yl-2-[(3,4,8,8-tetramethyl-2-oxo-9,10-dihydropyrano[2,3-h]chromen-5-yl)oxy]acetamide |
| SMILES | Cc1c(C)c2c(OCC(=O)Nc3cccnc3)cc3c(c2oc1=O)CCC(C)(C)O3 |
| InChI | InChI=1S/C23H24N2O5/c1-13-14(2)22(27)29-21-16-7-8-23(3,4)30-17(16)10-18(20(13)21)28-12-19(26)25-15-6-5-9-24-11-15/h5-6,9-11H,7-8,12H2,1-4H3,(H,25,26) |
| InChIKey | MASKHUXEBQKXCA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|