C20H27N3OS — CID 8017325
1-[[2-(1-adamantyl)acetyl]amino]-3-(2-methylphenyl)thiourea (PubChem CID 8017325) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-[[2-(1-adamantyl)acetyl]amino]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[[2-(1-adamantyl)acetyl]amino]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 8017325 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-[[2-(1-adamantyl)acetyl]amino]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)NNC(=O)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H27N3OS/c1-13-4-2-3-5-17(13)21-19(25)23-22-18(24)12-20-9-14-6-15(10-20)8-16(7-14)11-20/h2-5,14-16H,6-12H2,1H3,(H,22,24)(H2,21,23,25) |
| InChIKey | YMWDQFKHBTXXQM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|