C20H18N2O — CID 801778
2-(4-phenylphenyl)-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 801778) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-(4-phenylphenyl)-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 801778 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(4-phenylphenyl)-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)NCc1cccnc1 |
| InChI | InChI=1S/C20H18N2O/c23-20(22-15-17-5-4-12-21-14-17)13-16-8-10-19(11-9-16)18-6-2-1-3-7-18/h1-12,14H,13,15H2,(H,22,23) |
| InChIKey | SRUDJIQKKBQOHI-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |