C13H16N2OS — CID 801827
(8R)-6,6,8-trimethyl-3,5,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 801827) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is (8R)-6,6,8-trimethyl-3,5,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (8R)-6,6,8-trimethyl-3,5,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 801827 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (8R)-6,6,8-trimethyl-3,5,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@@H]1CC(C)(C)Cc2c1sc1nc[nH]c(=O)c21 |
| InChI | InChI=1S/C13H16N2OS/c1-7-4-13(2,3)5-8-9-11(16)14-6-15-12(9)17-10(7)8/h6-7H,4-5H2,1-3H3,(H,14,15,16)/t7-/m1/s1 |
| InChIKey | KHPXLZVZHSKEPY-SSDOTTSWSA-N |
| XLogP | 3.06 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |