About [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate (PubChem CID 8019001) has the molecular formula C17H18N2O3S
and a molecular weight of 330.41 g/mol. Its IUPAC name is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate.
Molecular Properties
| Compound Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate |
| PubChem CID | 8019001 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate |
| SMILES | CC(=O)N(c1ccccc1)c1nc(COC(=O)C2CCC2)cs1 |
| InChI | InChI=1S/C17H18N2O3S/c1-12(20)19(15-8-3-2-4-9-15)17-18-14(11-23-17)10-22-16(21)13-6-5-7-13/h2-4,8-9,11,13H,5-7,10H2,1H3 |
| InChIKey | NBPVUSOLWIGFGJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate?
The IUPAC name of [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate (CID 8019001) is [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate.
What is the SMILES notation for [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate?
The canonical SMILES for [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate is CC(=O)N(c1ccccc1)c1nc(COC(=O)C2CCC2)cs1.
What is the InChIKey of [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate?
The InChIKey is NBPVUSOLWIGFGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3S/c1-12(20)19(15-8-3-2-4-9-15)17-18-14(11-23-17)10-22-16(21)13-6-5-7-13/h2-4,8-9,11,13H,5-7,10H2,1H3.
What are the key properties of [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate?
[2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate has a molecular weight of 330.41 g/mol, XLogP of 3.67, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(N-acetylanilino)-1,3-thiazol-4-yl]methyl cyclobutanecarboxylate is sourced from PubChem (CID 8019001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).