C14H18N2O2S — CID 802097
3,5-dimethyl-1-(2,4,5-trimethylphenyl)sulfonylpyrazole (PubChem CID 802097) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 3,5-dimethyl-1-(2,4,5-trimethylphenyl)sulfonylpyrazole.
| Compound Name | 3,5-dimethyl-1-(2,4,5-trimethylphenyl)sulfonylpyrazole |
|---|---|
| PubChem CID | 802097 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 3,5-dimethyl-1-(2,4,5-trimethylphenyl)sulfonylpyrazole |
| SMILES | Cc1cc(C)n(S(=O)(=O)c2cc(C)c(C)cc2C)n1 |
| InChI | InChI=1S/C14H18N2O2S/c1-9-6-11(3)14(7-10(9)2)19(17,18)16-13(5)8-12(4)15-16/h6-8H,1-5H3 |
| InChIKey | QKPJQTWDLVXDIF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |