About (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol
(E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol (PubChem CID 802114) has the molecular formula C18H21NO
and a molecular weight of 267.37 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol.
Molecular Properties
| Compound Name | (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol |
| PubChem CID | 802114 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol |
| SMILES | CN(C)C/C=C/C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO/c1-19(2)15-9-14-18(20,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-14,20H,15H2,1-2H3/b14-9+ |
| InChIKey | NIUAGZPKSVQRLN-NTEUORMPSA-N |
| XLogP | 3.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol?
The IUPAC name of (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol (CID 802114) is (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol.
What is the SMILES notation for (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol?
The canonical SMILES for (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol is CN(C)C/C=C/C(O)(c1ccccc1)c1ccccc1.
What is the InChIKey of (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol?
The InChIKey is NIUAGZPKSVQRLN-NTEUORMPSA-N. The full InChI is InChI=1S/C18H21NO/c1-19(2)15-9-14-18(20,16-10-5-3-6-11-16)17-12-7-4-8-13-17/h3-14,20H,15H2,1-2H3/b14-9+.
What are the key properties of (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol?
(E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol has a molecular weight of 267.37 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-(dimethylamino)-1,1-diphenylbut-2-en-1-ol is sourced from PubChem (CID 802114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).