C14H14N2S — CID 802201
N-(2,4-dimethylphenyl)pyridine-2-carbothioamide (PubChem CID 802201) has the molecular formula C14H14N2S and a molecular weight of 242.35 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)pyridine-2-carbothioamide.
| Compound Name | N-(2,4-dimethylphenyl)pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 802201 |
| Molecular Formula | C14H14N2S |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | N-(2,4-dimethylphenyl)pyridine-2-carbothioamide |
| SMILES | Cc1ccc(NC(=S)c2ccccn2)c(C)c1 |
| InChI | InChI=1S/C14H14N2S/c1-10-6-7-12(11(2)9-10)16-14(17)13-5-3-4-8-15-13/h3-9H,1-2H3,(H,16,17) |
| InChIKey | GQWLGOPNAWCYAQ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|