C19H14ClN3O4 — CID 8022288
[2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 8022288) has the molecular formula C19H14ClN3O4 and a molecular weight of 383.79 g/mol. Its IUPAC name is [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8022288 |
| Molecular Formula | C19H14ClN3O4 |
| Molecular Weight | 383.79 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | [2-oxo-2-[(5-phenyl-1,3,4-oxadiazol-2-yl)amino]ethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1ccccc1Cl)Nc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C19H14ClN3O4/c20-15-9-5-4-6-13(15)10-11-17(25)26-12-16(24)21-19-23-22-18(27-19)14-7-2-1-3-8-14/h1-11H,12H2,(H,21,23,24)/b11-10+ |
| InChIKey | FFBVETXVFFMFGF-ZHACJKMWSA-N |
| XLogP | 3.59 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.79 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|