About (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one
(6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one (PubChem CID 8022545) has the molecular formula C17H11BrO
and a molecular weight of 311.18 g/mol. Its IUPAC name is (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one.
Molecular Properties
| Compound Name | (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one |
| PubChem CID | 8022545 |
| Molecular Formula | C17H11BrO |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one |
| SMILES | O=C1c2ccccc2C2=CC=C(Br)C3=CC=C[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C17H11BrO/c18-15-9-8-11-10-4-1-2-5-12(10)17(19)14-7-3-6-13(15)16(11)14/h1-9,14,16H/t14-,16-/m1/s1 |
| InChIKey | UAFJIWXCPYCRTI-GDBMZVCRSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one?
The IUPAC name of (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one (CID 8022545) is (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one.
What is the SMILES notation for (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one?
The canonical SMILES for (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one is O=C1c2ccccc2C2=CC=C(Br)C3=CC=C[C@@H]1[C@@H]32.
What is the InChIKey of (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one?
The InChIKey is UAFJIWXCPYCRTI-GDBMZVCRSA-N. The full InChI is InChI=1S/C17H11BrO/c18-15-9-8-11-10-4-1-2-5-12(10)17(19)14-7-3-6-13(15)16(11)14/h1-9,14,16H/t14-,16-/m1/s1.
What are the key properties of (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one?
(6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one has a molecular weight of 311.18 g/mol, XLogP of 4.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one is sourced from PubChem (CID 8022545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).