C17H11BrO — CID 8022545
(6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one (PubChem CID 8022545) has the molecular formula C17H11BrO and a molecular weight of 311.18 g/mol. Its IUPAC name is (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one.
| Compound Name | (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one |
|---|---|
| PubChem CID | 8022545 |
| Molecular Formula | C17H11BrO |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | (6aR,11cR)-3-bromo-6a,11c-dihydrobenzo[a]phenalen-7-one |
| SMILES | O=C1c2ccccc2C2=CC=C(Br)C3=CC=C[C@@H]1[C@@H]32 |
| InChI | InChI=1S/C17H11BrO/c18-15-9-8-11-10-4-1-2-5-12(10)17(19)14-7-3-6-13(15)16(11)14/h1-9,14,16H/t14-,16-/m1/s1 |
| InChIKey | UAFJIWXCPYCRTI-GDBMZVCRSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |