About 1,3-diethylperimidin-2-one
1,3-diethylperimidin-2-one (PubChem CID 802300) has the molecular formula C15H16N2O
and a molecular weight of 240.31 g/mol. Its IUPAC name is 1,3-diethylperimidin-2-one.
Molecular Properties
| Compound Name | 1,3-diethylperimidin-2-one |
| PubChem CID | 802300 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1,3-diethylperimidin-2-one |
| SMILES | CCN1C(=O)N(CC)c2cccc3cccc1c23 |
| InChI | InChI=1S/C15H16N2O/c1-3-16-12-9-5-7-11-8-6-10-13(14(11)12)17(4-2)15(16)18/h5-10H,3-4H2,1-2H3 |
| InChIKey | GGJMKLZRNHEOJQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-diethylperimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethylperimidin-2-one?
The IUPAC name of 1,3-diethylperimidin-2-one (CID 802300) is 1,3-diethylperimidin-2-one.
What is the SMILES notation for 1,3-diethylperimidin-2-one?
The canonical SMILES for 1,3-diethylperimidin-2-one is CCN1C(=O)N(CC)c2cccc3cccc1c23.
What is the InChIKey of 1,3-diethylperimidin-2-one?
The InChIKey is GGJMKLZRNHEOJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O/c1-3-16-12-9-5-7-11-8-6-10-13(14(11)12)17(4-2)15(16)18/h5-10H,3-4H2,1-2H3.
What are the key properties of 1,3-diethylperimidin-2-one?
1,3-diethylperimidin-2-one has a molecular weight of 240.31 g/mol, XLogP of 3.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethylperimidin-2-one is sourced from PubChem (CID 802300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).