C17H18F3N5O — CID 8023118
(2S)-2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 8023118) has the molecular formula C17H18F3N5O and a molecular weight of 365.36 g/mol. Its IUPAC name is (2S)-2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 8023118 |
| Molecular Formula | C17H18F3N5O |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | (2S)-2-(4-pyrimidin-2-ylpiperazin-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | C[C@@H](C(=O)Nc1ccc(F)c(F)c1F)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H18F3N5O/c1-11(16(26)23-13-4-3-12(18)14(19)15(13)20)24-7-9-25(10-8-24)17-21-5-2-6-22-17/h2-6,11H,7-10H2,1H3,(H,23,26)/t11-/m0/s1 |
| InChIKey | IVBBDFFJVPHCNZ-NSHDSACASA-N |
| XLogP | 2.04 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|