C17H13N5O3 — CID 8023690
2-(2,3-dioxoindol-1-yl)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)acetamide (PubChem CID 8023690) has the molecular formula C17H13N5O3 and a molecular weight of 335.32 g/mol. Its IUPAC name is 2-(2,3-dioxoindol-1-yl)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)acetamide.
| Compound Name | 2-(2,3-dioxoindol-1-yl)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 8023690 |
| Molecular Formula | C17H13N5O3 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-(2,3-dioxoindol-1-yl)-N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)C(=O)c2ccccc21)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C17H13N5O3/c23-15(18-9-14-20-19-13-7-3-4-8-21(13)14)10-22-12-6-2-1-5-11(12)16(24)17(22)25/h1-8H,9-10H2,(H,18,23) |
| InChIKey | PTTLPSAFWKNMQY-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|