C10H9N7 — CID 802375
2-phenyl-5-(1,2,4-triazol-4-yl)-1,2,4-triazol-3-amine (PubChem CID 802375) has the molecular formula C10H9N7 and a molecular weight of 227.23 g/mol. Its IUPAC name is 2-phenyl-5-(1,2,4-triazol-4-yl)-1,2,4-triazol-3-amine.
| Compound Name | 2-phenyl-5-(1,2,4-triazol-4-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 802375 |
| Molecular Formula | C10H9N7 |
| Molecular Weight | 227.23 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-phenyl-5-(1,2,4-triazol-4-yl)-1,2,4-triazol-3-amine |
| SMILES | Nc1nc(-n2cnnc2)nn1-c1ccccc1 |
| InChI | InChI=1S/C10H9N7/c11-9-14-10(16-6-12-13-7-16)15-17(9)8-4-2-1-3-5-8/h1-7H,(H2,11,14,15) |
| InChIKey | VLYLPWAKFIJSMK-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.23 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |