About (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide
(E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide (PubChem CID 802434) has the molecular formula C13H13N3O2
and a molecular weight of 243.27 g/mol. Its IUPAC name is (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide |
| PubChem CID | 802434 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide |
| SMILES | Cc1cc(C)nc(NC(=O)/C=C/c2ccco2)n1 |
| InChI | InChI=1S/C13H13N3O2/c1-9-8-10(2)15-13(14-9)16-12(17)6-5-11-4-3-7-18-11/h3-8H,1-2H3,(H,14,15,16,17)/b6-5+ |
| InChIKey | CAJITGFONOSGLR-AATRIKPKSA-N |
| XLogP | 2.34 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide?
The IUPAC name of (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide (CID 802434) is (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide.
What is the SMILES notation for (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide?
The canonical SMILES for (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide is Cc1cc(C)nc(NC(=O)/C=C/c2ccco2)n1.
What is the InChIKey of (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide?
The InChIKey is CAJITGFONOSGLR-AATRIKPKSA-N. The full InChI is InChI=1S/C13H13N3O2/c1-9-8-10(2)15-13(14-9)16-12(17)6-5-11-4-3-7-18-11/h3-8H,1-2H3,(H,14,15,16,17)/b6-5+.
What are the key properties of (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide?
(E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide has a molecular weight of 243.27 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(4,6-dimethylpyrimidin-2-yl)-3-(furan-2-yl)prop-2-enamide is sourced from PubChem (CID 802434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).