C11H17N3O5 — CID 8024648
5-(2,2-dimethoxyethyliminomethyl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 8024648) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 5-(2,2-dimethoxyethyliminomethyl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2,2-dimethoxyethyliminomethyl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 8024648 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 5-(2,2-dimethoxyethyliminomethyl)-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | COC(C/N=C/C1C(=O)N(C)C(=O)N(C)C1=O)OC |
| InChI | InChI=1S/C11H17N3O5/c1-13-9(15)7(10(16)14(2)11(13)17)5-12-6-8(18-3)19-4/h5,7-8H,6H2,1-4H3/b12-5+ |
| InChIKey | FOKSYHMHGQQCKT-LFYBBSHMSA-N |
| XLogP | -0.66 |
| TPSA | 88.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|