C14H30NO+ — CID 8024889
3-ethoxypropyl-[(1R,5S)-3,3,5-trimethylcyclohexyl]azanium (PubChem CID 8024889) has the molecular formula C14H30NO+ and a molecular weight of 228.40 g/mol. Its IUPAC name is 3-ethoxypropyl-[(1R,5S)-3,3,5-trimethylcyclohexyl]azanium.
| Compound Name | 3-ethoxypropyl-[(1R,5S)-3,3,5-trimethylcyclohexyl]azanium |
|---|---|
| PubChem CID | 8024889 |
| Molecular Formula | C14H30NO+ |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.23 |
| IUPAC Name | 3-ethoxypropyl-[(1R,5S)-3,3,5-trimethylcyclohexyl]azanium |
| SMILES | CCOCCC[NH2+][C@@H]1C[C@@H](C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H29NO/c1-5-16-8-6-7-15-13-9-12(2)10-14(3,4)11-13/h12-13,15H,5-11H2,1-4H3/p+1/t12-,13-/m1/s1 |
| InChIKey | VWPDFPJVRWAPBU-CHWSQXEVSA-O |
| XLogP | 2.19 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|