About azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone
azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone (PubChem CID 802559) has the molecular formula C16H22BrNO
and a molecular weight of 324.26 g/mol. Its IUPAC name is azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone.
Molecular Properties
| Compound Name | azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone |
| PubChem CID | 802559 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone |
| SMILES | Cc1c(Br)cc(C(=O)N2CCCCCC2)c(C)c1C |
| InChI | InChI=1S/C16H22BrNO/c1-11-12(2)14(10-15(17)13(11)3)16(19)18-8-6-4-5-7-9-18/h10H,4-9H2,1-3H3 |
| InChIKey | DFDQFCJMCSOKMW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone?
The IUPAC name of azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone (CID 802559) is azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone.
What is the SMILES notation for azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone?
The canonical SMILES for azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone is Cc1c(Br)cc(C(=O)N2CCCCCC2)c(C)c1C.
What is the InChIKey of azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone?
The InChIKey is DFDQFCJMCSOKMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO/c1-11-12(2)14(10-15(17)13(11)3)16(19)18-8-6-4-5-7-9-18/h10H,4-9H2,1-3H3.
What are the key properties of azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone?
azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone has a molecular weight of 324.26 g/mol, XLogP of 4.39, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azepan-1-yl-(5-bromo-2,3,4-trimethylphenyl)methanone is sourced from PubChem (CID 802559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).