C18H17FN4O2 — CID 802942
5-fluoro-2-N,4-N-bis(4-methoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 802942) has the molecular formula C18H17FN4O2 and a molecular weight of 340.36 g/mol. Its IUPAC name is 5-fluoro-2-N,4-N-bis(4-methoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-fluoro-2-N,4-N-bis(4-methoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 802942 |
| Molecular Formula | C18H17FN4O2 |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 5-fluoro-2-N,4-N-bis(4-methoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1ccc(Nc2ncc(F)c(Nc3ccc(OC)cc3)n2)cc1 |
| InChI | InChI=1S/C18H17FN4O2/c1-24-14-7-3-12(4-8-14)21-17-16(19)11-20-18(23-17)22-13-5-9-15(25-2)10-6-13/h3-11H,1-2H3,(H2,20,21,22,23) |
| InChIKey | DKMPKZLVZFPNDI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |